1-(2-bromophenyl)-2-diazonioethenolate
1-(2-bromophenyl)-2-diazonioethenolate structure
|
Common Name | 1-(2-bromophenyl)-2-diazonioethenolate | ||
|---|---|---|---|---|
| CAS Number | 46004-44-8 | Molecular Weight | 225.04200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-bromophenyl)-2-diazonioethenolate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H5BrN2O |
|---|---|
| Molecular Weight | 225.04200 |
| Exact Mass | 223.95900 |
| PSA | 54.46000 |
| LogP | 2.01346 |
| InChIKey | SQOCKNFREUXBEQ-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=CC(=O)c1ccccc1Br |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~93%
1-(2-bromopheny... CAS#:46004-44-8 |
| Literature: Nimgirawath; Taylor Australian Journal of Chemistry, 1983 , vol. 36, # 5 p. 1061 - 1065 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 2 | |
CAS#:49851-55-0
CAS#:18698-97-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Brom-benzoyl-diazomethan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(2-bromophenyl)-2-diazonioethenolate? |
| A: The English name of 1-(2-bromophenyl)-2-diazonioethenolate is 1-(2-bromophenyl)-2-diazonioethenolate. |
| Q: What is the SMILES notation of 1-(2-bromophenyl)-2-diazonioethenolate? |
| A: SMILES notation of 1-(2-bromophenyl)-2-diazonioethenolate is [N-]=[N+]=CC(=O)c1ccccc1Br. |
| Q: What is the CAS number of 1-(2-bromophenyl)-2-diazonioethenolate? |
| A: CAS number of 1-(2-bromophenyl)-2-diazonioethenolate is 46004-44-8. |
| Q: What is the InChIKey of 1-(2-bromophenyl)-2-diazonioethenolate? |
| A: InChIKey of 1-(2-bromophenyl)-2-diazonioethenolate is SQOCKNFREUXBEQ-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 1-(2-bromophenyl)-2-diazonioethenolate? |
| A: Related upstream materials(CAS) of 1-(2-bromophenyl)-2-diazonioethenolate: 186581-53-3;7154-66-7. |
| Q: What is the LogP of 1-(2-bromophenyl)-2-diazonioethenolate? |
| A: LogP of 1-(2-bromophenyl)-2-diazonioethenolate is 2.01346. |
| Q: What is the molecular formula of 1-(2-bromophenyl)-2-diazonioethenolate? |
| A: Molecular formula of 1-(2-bromophenyl)-2-diazonioethenolate is C8H5BrN2O. |
| Q: What English synonyms does 1-(2-bromophenyl)-2-diazonioethenolate have? |
| A: English synonyms of 1-(2-bromophenyl)-2-diazonioethenolate: 2-Brom-benzoyl-diazomethan. |
| Q: What is the molecular weight of 1-(2-bromophenyl)-2-diazonioethenolate? |
| A: Molecular weight of 1-(2-bromophenyl)-2-diazonioethenolate is 225.04200. |
| Q: What is the polar surface area (PSA) of 1-(2-bromophenyl)-2-diazonioethenolate? |
| A: Polar surface area (PSA) of 1-(2-bromophenyl)-2-diazonioethenolate is 54.46000. |