2,4-dimethyl-8-phenyl-7,9-diaza-8$l^C14H15N2OP-phosphabicyclo[4.3.0]nona-1,3,5-triene 8-oxide structure
|
Common Name | 2,4-dimethyl-8-phenyl-7,9-diaza-8$l^C14H15N2OP-phosphabicyclo[4.3.0]nona-1,3,5-triene 8-oxide | ||
|---|---|---|---|---|
| CAS Number | 4602-06-6 | Molecular Weight | 258.25500 | |
| Density | 1.26g/cm3 | Boiling Point | 403.4ºC at 760 mmHg | |
| Molecular Formula | C14H15N2OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.8ºC | |
| Name | 4,6-dimethyl-2-phenyl-1,3-dihydro-1,3,2λ5-benzodiazaphosphole 2-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 403.4ºC at 760 mmHg |
| Molecular Formula | C14H15N2OP |
| Molecular Weight | 258.25500 |
| Flash Point | 197.8ºC |
| Exact Mass | 258.09200 |
| PSA | 50.94000 |
| LogP | 3.93540 |
| Index of Refraction | 1.629 |
| InChIKey | QWMDIBRGQGPOAA-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2c(c1)NP(=O)(c1ccccc1)N2 |
|
~%
2,4-dimethyl-8-... CAS#:4602-06-6 |
| Literature: Dannley,R.L.; Grava,A. Canadian Journal of Chemistry, 1965 , vol. 43, p. 3377 - 3386 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,6-dimethyl-2-phenyl-2,3-dihydro-1h-1,3,2-benzodiazaphosphole 2-oxide |
| 4,6-Dimethyl-2-phenyl-2,3-dihydro-1H-1,3,2-benzodiazaphosphol-2-oxid |