3,4-dichloro-8-phenyl-7,9-diaza-8$l^C12H9Cl2N2OP-phosphabicyclo[4.3.0]nona-1,3,5-triene 8-oxide
Modify Date: 2025-09-01 18:36:19
![3,4-dichloro-8-phenyl-7,9-diaza-8$l^C12H9Cl2N2OP-phosphabicyclo[4.3.0]nona-1,3,5-triene 8-oxide Structure](https://image.chemsrc.com/caspic/472/4602-08-8.png)
3,4-dichloro-8-phenyl-7,9-diaza-8$l^C12H9Cl2N2OP-phosphabicyclo[4.3.0]nona-1,3,5-triene 8-oxide structure
|
Common Name | 3,4-dichloro-8-phenyl-7,9-diaza-8$l^C12H9Cl2N2OP-phosphabicyclo[4.3.0]nona-1,3,5-triene 8-oxide | ||
|---|---|---|---|---|
| CAS Number | 4602-08-8 | Molecular Weight | 299.09200 | |
| Density | 1.53g/cm3 | Boiling Point | 436.7ºC at 760 mmHg | |
| Molecular Formula | C12H9Cl2N2OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.9ºC | |
| Name | 5,6-dichloro-2-phenyl-1,3-dihydro-1,3,2λ5-benzodiazaphosphole 2-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 436.7ºC at 760 mmHg |
| Molecular Formula | C12H9Cl2N2OP |
| Molecular Weight | 299.09200 |
| Flash Point | 217.9ºC |
| Exact Mass | 297.98300 |
| PSA | 50.94000 |
| LogP | 4.62540 |
| Index of Refraction | 1.674 |
| InChIKey | HEYUBNSGYJVYCL-UHFFFAOYSA-N |
| SMILES | O=P1(c2ccccc2)Nc2cc(Cl)c(Cl)cc2N1 |
| HS Code | 2934999090 |
|---|
|
~%
3,4-dichloro-8-... CAS#:4602-08-8 |
| Literature: Dannley,R.L.; Grava,A. Canadian Journal of Chemistry, 1965 , vol. 43, p. 3377 - 3386 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,6-Dichlor-2-phenyl-2,3-dihydro-1H-1,3,2-benzodiazaphosphol-2-oxid |
| 5,6-Dichloro-2-phenyl-2,3-dihydro-1H-1,3,2-benzodiazaphosphole 2-oxide |