5-methyl-5-nitrohexan-2-one structure
|
Common Name | 5-methyl-5-nitrohexan-2-one | ||
|---|---|---|---|---|
| CAS Number | 4604-49-3 | Molecular Weight | 159.18300 | |
| Density | 1.033g/cm3 | Boiling Point | 248ºC at 760 mmHg | |
| Molecular Formula | C7H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.3ºC | |
| Name | 5-methyl-5-nitrohexan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.033g/cm3 |
|---|---|
| Boiling Point | 248ºC at 760 mmHg |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18300 |
| Flash Point | 103.3ºC |
| Exact Mass | 159.09000 |
| PSA | 62.89000 |
| LogP | 1.93410 |
| Index of Refraction | 1.438 |
| InChIKey | QWHNMIXUSPUHGO-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC(C)(C)[N+](=O)[O-] |
| HS Code | 2914700090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 4 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 5-methyl-5-nitrohexane-2-one |
| 5-methyl-5-nitro-2-hexanone |
| 5-Methyl-5-nitro-hexan-2-one |
| 2-Methyl-2-nitrohexan-5-one |
| 3-Methyl-3-nitrobutyl-methylketon |
| EINECS 225-006-2 |
| 2-Hexanone,5-methyl-5-nitro |
| 5-Methyl-5-nitro-hexan-2-on |