1,4-dibromo-2-chloro-1,1,2-trifluorodecane
1,4-dibromo-2-chloro-1,1,2-trifluorodecane structure
|
Common Name | 1,4-dibromo-2-chloro-1,1,2-trifluorodecane | ||
|---|---|---|---|---|
| CAS Number | 461-01-8 | Molecular Weight | 388.49000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16Br2ClF3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-dibromo-2-chloro-1,1,2-trifluorodecane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16Br2ClF3 |
|---|---|
| Molecular Weight | 388.49000 |
| Exact Mass | 385.92600 |
| LogP | 6.00270 |
| InChIKey | IVXKUGOCECZHGU-UHFFFAOYSA-N |
| SMILES | CCCCCCC(Br)CC(F)(Cl)C(F)(F)Br |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:101823-24-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Decane,1,4-dibromo-2-chloro-1,1,2-trifluoro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 461-01-8? |
| A: Chinese name of 461-01-8 is 461-01-8. |
| Q: What is the English name of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane? |
| A: The English name of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane is 1,4-dibromo-2-chloro-1,1,2-trifluorodecane. |
| Q: What is the SMILES notation of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane? |
| A: SMILES notation of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane is CCCCCCC(Br)CC(F)(Cl)C(F)(F)Br. |
| Q: What are the downstream products of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane? |
| A: Related downstream products(CAS) of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane: 101823-24-9. |
| Q: What English synonyms does 1,4-dibromo-2-chloro-1,1,2-trifluorodecane have? |
| A: English synonyms of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane: Decane,1,4-dibromo-2-chloro-1,1,2-trifluoro. |
| Q: What is the molecular weight of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane? |
| A: Molecular weight of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane is 388.49000. |
| Q: What is the LogP of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane? |
| A: LogP of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane is 6.00270. |
| Q: What is the molecular formula of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane? |
| A: Molecular formula of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane is C10H16Br2ClF3. |
| Q: What is the InChIKey of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane? |
| A: InChIKey of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane is IVXKUGOCECZHGU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane? |
| A: CAS number of 1,4-dibromo-2-chloro-1,1,2-trifluorodecane is 461-01-8. |