4-(4-ethoxyphenyl)-5-propyl-1,3-thiazol-2-amine
Modify Date: 2025-09-01 07:46:32
4-(4-ethoxyphenyl)-5-propyl-1,3-thiazol-2-amine structure
|
Common Name | 4-(4-ethoxyphenyl)-5-propyl-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 461033-41-0 | Molecular Weight | 262.37100 | |
| Density | 1.143g/cm3 | Boiling Point | 441.2ºC at 760 mmHg | |
| Molecular Formula | C14H18N2OS | Melting Point | N/A | |
| MSDS | USA | Flash Point | 220.6ºC | |
| Name | 4-(4-ethoxyphenyl)-5-propyl-1,3-thiazol-2-amine |
|---|
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 441.2ºC at 760 mmHg |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.37100 |
| Flash Point | 220.6ºC |
| Exact Mass | 262.11400 |
| PSA | 76.38000 |
| LogP | 4.32470 |
| Index of Refraction | 1.586 |
| InChIKey | RDYHRHLOWLYZPQ-UHFFFAOYSA-N |
| SMILES | CCCc1sc(N)nc1-c1ccc(OCC)cc1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |