potassium,2,3,4,5,6-pentafluorophenolate
potassium,2,3,4,5,6-pentafluorophenolate structure
|
Common Name | potassium,2,3,4,5,6-pentafluorophenolate | ||
|---|---|---|---|---|
| CAS Number | 4615-85-4 | Molecular Weight | 222.15400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6F5KO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | potassium,2,3,4,5,6-pentafluorophenolate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6F5KO |
|---|---|
| Molecular Weight | 222.15400 |
| Exact Mass | 221.95100 |
| PSA | 23.06000 |
| LogP | 2.52590 |
| InChIKey | OMOSXHQDCWPOKM-UHFFFAOYSA-M |
| SMILES | [K+].[O-]c1c(F)c(F)c(F)c(F)c1F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2908199090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 6 | |
CAS#:1800-30-2
CAS#:19847-41-7
CAS#:2663-96-9
CAS#:29897-30-1![trimethoxy-[(2,3,4,5,6-pentafluorophenoxy)methyl]silane structure](https://image.chemsrc.com/caspic/155/72897-23-5.png)
CAS#:72897-23-5
CAS#:6804-37-1This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Phenol,pentafluoro-,potassium salt |
| Potassium pentafluorophenolate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of potassium,2,3,4,5,6-pentafluorophenolate? |
| A: CAS number of potassium,2,3,4,5,6-pentafluorophenolate is 4615-85-4. |
| Q: What is the polar surface area (PSA) of potassium,2,3,4,5,6-pentafluorophenolate? |
| A: Polar surface area (PSA) of potassium,2,3,4,5,6-pentafluorophenolate is 23.06000. |
| Q: What are the downstream products of potassium,2,3,4,5,6-pentafluorophenolate? |
| A: Related downstream products(CAS) of potassium,2,3,4,5,6-pentafluorophenolate: 1800-30-2;19847-41-7;2663-96-9;29897-30-1;72897-23-5;6804-37-1. |
| Q: What is the Chinese name of 4615-85-4? |
| A: Chinese name of 4615-85-4 is 4615-85-4. |
| Q: What is the LogP of potassium,2,3,4,5,6-pentafluorophenolate? |
| A: LogP of potassium,2,3,4,5,6-pentafluorophenolate is 2.52590. |
| Q: What is the InChIKey of potassium,2,3,4,5,6-pentafluorophenolate? |
| A: InChIKey of potassium,2,3,4,5,6-pentafluorophenolate is OMOSXHQDCWPOKM-UHFFFAOYSA-M. |
| Q: What is the English name of potassium,2,3,4,5,6-pentafluorophenolate? |
| A: The English name of potassium,2,3,4,5,6-pentafluorophenolate is potassium,2,3,4,5,6-pentafluorophenolate. |
| Q: What is the molecular weight of potassium,2,3,4,5,6-pentafluorophenolate? |
| A: Molecular weight of potassium,2,3,4,5,6-pentafluorophenolate is 222.15400. |
| Q: What is the SMILES notation of potassium,2,3,4,5,6-pentafluorophenolate? |
| A: SMILES notation of potassium,2,3,4,5,6-pentafluorophenolate is [K+].[O-]c1c(F)c(F)c(F)c(F)c1F. |
| Q: What is the molecular formula of potassium,2,3,4,5,6-pentafluorophenolate? |
| A: Molecular formula of potassium,2,3,4,5,6-pentafluorophenolate is C6F5KO. |