[(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate
![[(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate Structure](https://image.chemsrc.com/caspic/245/461675-91-2.png)
[(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate structure
|
Common Name | [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate | ||
|---|---|---|---|---|
| CAS Number | 461675-91-2 | Molecular Weight | 257.05200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H7O8P2--- | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H7O8P2--- |
|---|---|
| Molecular Weight | 257.05200 |
| Exact Mass | 256.96200 |
| PSA | 158.47000 |
| LogP | 1.67250 |
| InChIKey | XWBOFXGOOQOHDW-UHFFFAOYSA-K |
| SMILES | CC(C=O)=CCOP(=O)([O-])OP(=O)([O-])[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate? |
| A: Molecular weight of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate is 257.05200. |
| Q: What is the English name of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate? |
| A: The English name of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate is [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate. |
| Q: What is the CAS number of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate? |
| A: CAS number of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate is 461675-91-2. |
| Q: What is the LogP of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate? |
| A: LogP of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate is 1.67250. |
| Q: What is the molecular formula of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate? |
| A: Molecular formula of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate is C5H7O8P2---. |
| Q: What is the polar surface area (PSA) of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate? |
| A: Polar surface area (PSA) of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate is 158.47000. |
| Q: What are the upstream materials of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate? |
| A: Related upstream materials(CAS) of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate: 80121-59-1;1838-94-4. |
| Q: What is the SMILES notation of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate? |
| A: SMILES notation of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate is CC(C=O)=CCOP(=O)([O-])OP(=O)([O-])[O-]. |
| Q: What is the InChIKey of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate? |
| A: InChIKey of [(3-methyl-4-oxobut-2-enoxy)-oxidophosphoryl] phosphate is XWBOFXGOOQOHDW-UHFFFAOYSA-K. |
| Q: What is the Chinese name of 461675-91-2? |
| A: Chinese name of 461675-91-2 is 461675-91-2. |