(2-AMINOBENZYL)TRIPHENYLPHOSPHONIUMBROMIDE structure
|
Common Name | (2-AMINOBENZYL)TRIPHENYLPHOSPHONIUMBROMIDE | ||
|---|---|---|---|---|
| CAS Number | 461694-82-6 | Molecular Weight | 253.33900 | |
| Density | 1.071g/cm3 | Boiling Point | 418.664ºC at 760 mmHg | |
| Molecular Formula | C17H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.001ºC | |
| Name | (2-aminophenyl)-(4-tert-butylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.071g/cm3 |
|---|---|
| Boiling Point | 418.664ºC at 760 mmHg |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.33900 |
| Flash Point | 207.001ºC |
| Exact Mass | 253.14700 |
| PSA | 43.09000 |
| LogP | 4.37850 |
| Index of Refraction | 1.58 |
| InChIKey | GQQPPSHWUMMVBN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)c2ccccc2N)cc1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Amino-4'-tert.-butyl-benzophenon |
| (2-amino-phenyl)-(4-tert-butyl-phenyl)methanone |