phenylglycolic acid, compound with 2-(dimethylamino)ethyl-α-hydroxy-α-phenylbenzeneacetate (1:1) structure
|
Common Name | phenylglycolic acid, compound with 2-(dimethylamino)ethyl-α-hydroxy-α-phenylbenzeneacetate (1:1) | ||
|---|---|---|---|---|
| CAS Number | 4618-47-7 | Molecular Weight | 451.51200 | |
| Density | N/A | Boiling Point | 464.1ºC at 760 mmHg | |
| Molecular Formula | C26H29NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.5ºC | |
| Name | 2-[2-(dimethylamino)-3-ethylphenyl]-2-hydroxy-2-phenylacetic acid,2-hydroxy-2-phenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 464.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.51200 |
| Flash Point | 234.5ºC |
| Exact Mass | 451.19900 |
| PSA | 118.30000 |
| LogP | 3.44010 |
| InChIKey | BKEKZFSQSWMESG-UHFFFAOYSA-N |
| SMILES | CCc1cccc(C(O)(C(=O)O)c2ccccc2)c1N(C)C.O=C(O)C(O)c1ccccc1 |
|
~%
phenylglycolic ... CAS#:4618-47-7 |
| Literature: Ford-Moore; Ing Journal of the Chemical Society, 1947 , p. 59 |
| EINECS 225-028-2 |
| phenylglycolic acid |