2-(4-methylquinolin-2-yl)sulfanylpropanoic acid structure
|
Common Name | 2-(4-methylquinolin-2-yl)sulfanylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 462068-47-9 | Molecular Weight | 247.31300 | |
| Density | 1.29g/cm3 | Boiling Point | 439.9ºC at 760 mmHg | |
| Molecular Formula | C13H13NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.8ºC | |
| Name | 2-(4-methylquinolin-2-yl)sulfanylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 439.9ºC at 760 mmHg |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.31300 |
| Flash Point | 219.8ºC |
| Exact Mass | 247.06700 |
| PSA | 75.49000 |
| LogP | 3.10840 |
| Index of Refraction | 1.655 |
| InChIKey | PZYFRXRGRLCMPV-UHFFFAOYSA-N |
| SMILES | Cc1cc(SC(C)C(=O)O)nc2ccccc12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms1487c20 |