ethyl 5-formyl-2-oxo-1,3-dihydroimidazole-4-carboxylate structure
|
Common Name | ethyl 5-formyl-2-oxo-1,3-dihydroimidazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 462095-37-0 | Molecular Weight | 184.14900 | |
| Density | 1.447g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 5-formyl-2-oxo-1,3-dihydroimidazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.447g/cm3 |
|---|---|
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.14900 |
| Exact Mass | 184.04800 |
| PSA | 92.02000 |
| Index of Refraction | 1.581 |
| InChIKey | YGHAVQHYGSCQPL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c(=O)[nH]c1C=O |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-formyl-2,3-dihydro-2-oxo-1h-imidazole-4-carboxylic acid ethyl ester |