9,9-Diphenylfluorene-2-Boronic acid pinacol ester structure
|
Common Name | 9,9-Diphenylfluorene-2-Boronic acid pinacol ester | ||
|---|---|---|---|---|
| CAS Number | 462128-39-8 | Molecular Weight | 444.372 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 556.2±29.0 °C at 760 mmHg | |
| Molecular Formula | C31H29BO2 | Melting Point | 198.0 to 202.0 °C | |
| MSDS | N/A | Flash Point | 290.2±24.3 °C | |
| Name | 2-(9,9-Diphenyl-9H-fluoren-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 556.2±29.0 °C at 760 mmHg |
| Melting Point | 198.0 to 202.0 °C |
| Molecular Formula | C31H29BO2 |
| Molecular Weight | 444.372 |
| Flash Point | 290.2±24.3 °C |
| Exact Mass | 444.226074 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | CQMUDHYVDPNPLZ-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)OC1(C)C |
| 1,3,2-Dioxaborolane, 2-(9,9-diphenyl-9H-fluoren-2-yl)-4,4,5,5-tetramethyl- |
| 2-(9,9-Diphenyl-9H-fluoren-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| 9,9-Diphenyl-9H-fluoren-2-ylboronic acid pinacol ester |
| 9,9-Diphenylfluorene-2-Boronic acid pinacol ester |