1,3,5-tris(4-methoxyphenyl)-1,3,5-triazinane-2,4,6-trione
Modify Date: 2025-11-08 23:18:32
1,3,5-tris(4-methoxyphenyl)-1,3,5-triazinane-2,4,6-trione structure
|
Common Name | 1,3,5-tris(4-methoxyphenyl)-1,3,5-triazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 4623-21-6 | Molecular Weight | 447.44000 | |
| Density | 1.34g/cm3 | Boiling Point | 617.7ºC at 760 mmHg | |
| Molecular Formula | C24H21N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327.4ºC | |
| Name | 1,3,5-tris(4-methoxyphenyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 617.7ºC at 760 mmHg |
| Molecular Formula | C24H21N3O6 |
| Molecular Weight | 447.44000 |
| Flash Point | 327.4ºC |
| Exact Mass | 447.14300 |
| PSA | 93.69000 |
| LogP | 2.16510 |
| Index of Refraction | 1.627 |
| InChIKey | HGUXHAYZQPYABT-UHFFFAOYSA-N |
| SMILES | COc1ccc(-n2c(=O)n(-c3ccc(OC)cc3)c(=O)n(-c3ccc(OC)cc3)c2=O)cc1 |
| HS Code | 2933699090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| tri-p-methoxyphenyl isocyanurate |