1-pyridin-2-yl-N-[2-(1-pyridin-2-ylethylideneamino)ethyl]ethanimine
Modify Date: 2025-09-23 19:11:46
![1-pyridin-2-yl-N-[2-(1-pyridin-2-ylethylideneamino)ethyl]ethanimine Structure](https://image.chemsrc.com/caspic/004/4626-65-7.png)
1-pyridin-2-yl-N-[2-(1-pyridin-2-ylethylideneamino)ethyl]ethanimine structure
|
Common Name | 1-pyridin-2-yl-N-[2-(1-pyridin-2-ylethylideneamino)ethyl]ethanimine | ||
|---|---|---|---|---|
| CAS Number | 4626-65-7 | Molecular Weight | 266.34100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-pyridin-2-yl-N-[2-(1-pyridin-2-ylethylideneamino)ethyl]ethanimine |
|---|
| Molecular Formula | C16H18N4 |
|---|---|
| Molecular Weight | 266.34100 |
| Exact Mass | 266.15300 |
| PSA | 50.50000 |
| LogP | 2.79480 |
| InChIKey | AVRQAPYSMVJCOY-UHFFFAOYSA-N |
| SMILES | CC(=NCCN=C(C)c1ccccn1)c1ccccn1 |
| HS Code | 2933399090 |
|---|
|
~%
1-pyridin-2-yl-... CAS#:4626-65-7 |
| Literature: Gao Russian Journal of Coordination Chemistry/Koordinatsionnaya Khimiya, 2012 , vol. 38, # 9 p. 604 - 608 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |