1,10-bis(1-piperidyl)decane-1,10-dione structure
|
Common Name | 1,10-bis(1-piperidyl)decane-1,10-dione | ||
|---|---|---|---|---|
| CAS Number | 4629-03-2 | Molecular Weight | 336.51200 | |
| Density | 1.025g/cm3 | Boiling Point | 525.6ºC at 760 mmHg | |
| Molecular Formula | C20H36N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.1ºC | |
| Name | 1,10-di(piperidin-1-yl)decane-1,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.025g/cm3 |
|---|---|
| Boiling Point | 525.6ºC at 760 mmHg |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.51200 |
| Flash Point | 222.1ºC |
| Exact Mass | 336.27800 |
| PSA | 40.62000 |
| LogP | 4.00800 |
| Index of Refraction | 1.505 |
| InChIKey | UYVVDMIBPUZBLO-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCCCCC(=O)N1CCCCC1)N1CCCCC1 |
| HS Code | 2933399090 |
|---|
|
~%
1,10-bis(1-pipe... CAS#:4629-03-2 |
| Literature: Wojcik; Adkins Journal of the American Chemical Society, 1934 , vol. 56, p. 2419,2422 |
|
~%
1,10-bis(1-pipe... CAS#:4629-03-2 |
| Literature: Wojcik; Adkins Journal of the American Chemical Society, 1934 , vol. 56, p. 2419,2422 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| HMS3093H05 |
| 1,10-Dipiperidino-decan-1,10-dion |
| 1,10-dipiperidino-decane-1,10-dione |
| N,N'-Sebacoyldipiperidin |
| 1,1'-decanedioyl-bis-piperidine |