2-(hydroxymethyl)-6-methoxy-4-nitro-oxane-3,5-diol structure
|
Common Name | 2-(hydroxymethyl)-6-methoxy-4-nitro-oxane-3,5-diol | ||
|---|---|---|---|---|
| CAS Number | 4631-21-4 | Molecular Weight | 223.18100 | |
| Density | 1.52g/cm3 | Boiling Point | 481.5ºC at 760 mmHg | |
| Molecular Formula | C7H13NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245ºC | |
| Name | 2-(hydroxymethyl)-6-methoxy-4-nitrooxane-3,5-diol |
|---|
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 481.5ºC at 760 mmHg |
| Molecular Formula | C7H13NO7 |
| Molecular Weight | 223.18100 |
| Flash Point | 245ºC |
| Exact Mass | 223.06900 |
| PSA | 124.97000 |
| Index of Refraction | 1.545 |
| InChIKey | PQPUXJMPHURQIH-UHFFFAOYSA-N |
| SMILES | COC1OC(CO)C(O)C([N+](=O)[O-])C1O |
| HS Code | 2932999099 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |