ritodrine hydrochloride
ritodrine hydrochloride structure
|
Common Name | ritodrine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 4635-27-2 | Molecular Weight | 287.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H21NO3 |
|---|---|
| Molecular Weight | 287.35400 |
| Exact Mass | 287.15200 |
| PSA | 72.72000 |
| LogP | 2.74290 |
| InChIKey | IOVGROKTTNBUGK-UHFFFAOYSA-N |
| SMILES | CC(NCCc1ccc(O)cc1)C(O)c1ccc(O)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-[1-hydroxy-2-[2-(4-hydroxyphenyl)ethylamino]propyl]phenol |
| ritodrine |
| Ritodrin |
| RITODRINE HYDROCHLORIDE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol? |
| A: CAS number of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol is 4635-27-2. |
| Q: What is the English name of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol? |
| A: The English name of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol is (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol. |
| Q: What is the SMILES notation of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol? |
| A: SMILES notation of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol is CC(NCCc1ccc(O)cc1)C(O)c1ccc(O)cc1. |
| Q: What is the InChIKey of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol? |
| A: InChIKey of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol is IOVGROKTTNBUGK-UHFFFAOYSA-N. |
| Q: What English synonyms does (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol have? |
| A: English synonyms of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol: 4-[1-hydroxy-2-[2-(4-hydroxyphenyl)ethylamino]propyl]phenol, ritodrine, Ritodrin, RITODRINE HYDROCHLORIDE. |
| Q: What is the polar surface area (PSA) of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol? |
| A: Polar surface area (PSA) of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol is 72.72000. |
| Q: What is the LogP of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol? |
| A: LogP of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol is 2.74290. |
| Q: What is the molecular formula of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol? |
| A: Molecular formula of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol is C17H21NO3. |
| Q: What is the molecular weight of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol? |
| A: Molecular weight of (-)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol is 287.35400. |