2-(N-methylphenylsulfonamido)acetic acid structure
|
Common Name | 2-(N-methylphenylsulfonamido)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 46376-16-3 | Molecular Weight | 229.25300 | |
| Density | 1.38g/cm3 | Boiling Point | 416ºC at 760mmHg | |
| Molecular Formula | C9H11NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.4ºC | |
| Name | 2-[benzenesulfonyl(methyl)amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 416ºC at 760mmHg |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.25300 |
| Flash Point | 205.4ºC |
| Exact Mass | 229.04100 |
| PSA | 83.06000 |
| LogP | 1.47250 |
| Index of Refraction | 1.576 |
| InChIKey | XQGWHYCLQRSQSQ-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)S(=O)(=O)c1ccccc1 |
| Storage condition | 2-8°C |
| HS Code | 2935009090 |
|---|
|
~%
2-(N-methylphen... CAS#:46376-16-3 |
| Literature: Thomas; Schotte Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1919 , vol. 104, p. 148 |
|
~%
2-(N-methylphen... CAS#:46376-16-3 |
| Literature: Michalew et al. Zhurnal Obshchei Khimii, 1959 , vol. 29, p. 3488,3491; engl. Ausg. S. 3453, 3455 |
|
~%
2-(N-methylphen... CAS#:46376-16-3 |
| Literature: Cocker; Lapworth Journal of the Chemical Society, 1931 , p. 1894,1897 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Glycine,N-methyl-N-(phenylsulfonyl) |
| N-Benzolsulfonyl-N-methyl-aminoessigsaeure |
| N-Benzolsulfonyl-sarkosin |
| [methyl(phenylsulfonyl)amino]acetic acid |
| 2-[methyl(phenylsulfonyl)amino]acetic acid |
| Sarkosin-N-(phenylsulfonyl) |
| N-Benzolsulfonyl-N-methyl-glycin |
| N-(phenylsulfonyl)sarcosin |
| N-benzenesulfonyl-N-methyl-glycine |
| N-Phenylsulfonyl-Sarcosine |