2-nitro-1-(2-nitrophenyl)ethanone structure
|
Common Name | 2-nitro-1-(2-nitrophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 46388-92-5 | Molecular Weight | 210.14400 | |
| Density | 1.443g/cm3 | Boiling Point | 400.6ºC at 760 mmHg | |
| Molecular Formula | C8H6N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.2ºC | |
| Name | 2-nitro-1-(2-nitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.443g/cm3 |
|---|---|
| Boiling Point | 400.6ºC at 760 mmHg |
| Molecular Formula | C8H6N2O5 |
| Molecular Weight | 210.14400 |
| Flash Point | 211.2ºC |
| Exact Mass | 210.02800 |
| PSA | 108.71000 |
| LogP | 2.10060 |
| Index of Refraction | 1.585 |
| InChIKey | SCNLKNKILDXNCK-UHFFFAOYSA-N |
| SMILES | O=C(C[N+](=O)[O-])c1ccccc1[N+](=O)[O-] |
|
~64%
2-nitro-1-(2-ni... CAS#:46388-92-5 |
| Literature: Ashwell, Mark A.; Jackson, Richard F. W. Synthesis, 1988 , # 3 p. 229 - 231 |
|
~%
2-nitro-1-(2-ni... CAS#:46388-92-5 |
| Literature: Canonica; Cardani Gazzetta Chimica Italiana, 1949 , vol. 79, p. 262,269 |
|
~%
2-nitro-1-(2-ni... CAS#:46388-92-5 |
| Literature: Seter (Strumza),J. Israel Journal of Chemistry, 1966 , vol. 4, p. 7 - 22 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Nitro-1-<2-nitro-phenyl>-aethan-1-on |