2,4-dihydro-4-[(2-methoxyphenyl)azo]-5-methyl-2-phenyl-3H-Pyrazol-3-one structure
|
Common Name | 2,4-dihydro-4-[(2-methoxyphenyl)azo]-5-methyl-2-phenyl-3H-Pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 4645-07-2 | Molecular Weight | 308.33500 | |
| Density | 1.24 | Boiling Point | 505.3ºC at 760 mmHg | |
| Molecular Formula | C17H16N4O2 | Melting Point | 166-167ºC | |
| MSDS | N/A | Flash Point | 259.4ºC | |
| Name | 2,4-dihydro-4-[(2-methoxyphenyl)azo]-5-methyl-2-phenyl-3H-Pyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24 |
|---|---|
| Boiling Point | 505.3ºC at 760 mmHg |
| Melting Point | 166-167ºC |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.33500 |
| Flash Point | 259.4ºC |
| Exact Mass | 308.12700 |
| PSA | 66.62000 |
| LogP | 3.07080 |
| Index of Refraction | 1.63 |
| InChIKey | UXNFQAZIRFBOKO-UHFFFAOYSA-N |
| SMILES | COc1ccccc1N=NC1C(=O)N(c2ccccc2)N=C1C |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Solvent Yellow 72 |
| 1-phenyl-3-methyl-4-(2-methoxybenzeneazo)-5-pyrazolone |
| 1-Phenyl-3-methyl-4-<2-methoxy-benzolazo>-5-pyrazolon |
| 4-[(2-Methoxyphenyl)azo]-5-methyl-2-phenyl-2H-pyrazol-3(4H)-one |
| 5-methyl-2-phenyl-2H-pyrazole-3,4-dione 4-[(2-methoxy-phenyl)-hydrazone] |