disodium,anthracene-9,10-diolate structure
|
Common Name | disodium,anthracene-9,10-diolate | ||
|---|---|---|---|---|
| CAS Number | 46492-07-3 | Molecular Weight | 254.19200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8Na2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | disodium,anthracene-9,10-diolate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H8Na2O2 |
|---|---|
| Molecular Weight | 254.19200 |
| Exact Mass | 254.03200 |
| PSA | 46.12000 |
| LogP | 4.28060 |
| InChIKey | RMEKRPRYWRUTKH-UHFFFAOYSA-L |
| SMILES | [Na+].[Na+].[O-]c1c2ccccc2c([O-])c2ccccc12 |
|
~%
disodium,anthra... CAS#:46492-07-3 |
| Literature: Alegria, Antonio; Moctezuma, Angel; Velazquez, Betty Journal of the Chemical Society, Faraday Transactions, 1993 , vol. 89, # 18 p. 3363 - 3370 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 9,10-anthrasemiquinone sodium salt |
| 9,10-Anthracenediol,disodium salt |
| disodium anthracene-9,10-diolate |
| 9,10-Anthrasemichinon-Na-Salz |
| Natrium-Anthrachinon-Radikal |