10-oxo-10-(oxolan-2-ylmethoxy)decanoic acid
Modify Date: 2025-11-25 22:40:22
10-oxo-10-(oxolan-2-ylmethoxy)decanoic acid structure
|
Common Name | 10-oxo-10-(oxolan-2-ylmethoxy)decanoic acid | ||
|---|---|---|---|---|
| CAS Number | 4650-83-3 | Molecular Weight | 286.36400 | |
| Density | 1.084g/cm3 | Boiling Point | 425.5ºC at 760 mmHg | |
| Molecular Formula | C15H26O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.3ºC | |
| Name | 10-oxo-10-(oxolan-2-ylmethoxy)decanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 425.5ºC at 760 mmHg |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.36400 |
| Flash Point | 150.3ºC |
| Exact Mass | 286.17800 |
| PSA | 72.83000 |
| LogP | 2.91400 |
| Index of Refraction | 1.475 |
| InChIKey | XRVATIVUESFWDO-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCCCCC(=O)OCC1CCCO1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Sebazinsaeure-mono-tetrahydrofurfurylester |
| decanedioic acid mono-tetrahydrofurfuryl ester |
| Tetrahydrofurfuryl hydrogen sebacate |
| EINECS 225-081-1 |
| 10-oxo-10-(tetrahydrofuran-2-ylmethoxy)decanoic acid |