5-(2,4-Dimethoxyphenyl)-5-oxopentanoic acid
Modify Date: 2025-09-02 20:18:54
5-(2,4-Dimethoxyphenyl)-5-oxopentanoic acid structure
|
Common Name | 5-(2,4-Dimethoxyphenyl)-5-oxopentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 4654-07-3 | Molecular Weight | 252.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2,4-Dimethoxyphenyl)-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16O5 |
|---|---|
| Molecular Weight | 252.26300 |
| Exact Mass | 252.10000 |
| PSA | 72.83000 |
| LogP | 2.14140 |
| InChIKey | UYJUMNIZLCRMCT-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCCC(=O)O)c(OC)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(2,4-Dimethoxy-benzoyl)-buttersaeure |
| 5-(2,4-DIMETHOXYPHENYL)-5-OXOVALERIC ACID |
| 4-(2',4'-Dimethoxybenzoyl)butyric acid |
| 5-(2,4-Dimethoxy-phenyl)-5-oxo-valeriansaeure |