N-(4-bromophenyl)sulfonylbenzenecarboximidoyl chloride structure
|
Common Name | N-(4-bromophenyl)sulfonylbenzenecarboximidoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 4655-44-1 | Molecular Weight | 358.63800 | |
| Density | 1.54g/cm3 | Boiling Point | 463ºC at 760mmHg | |
| Molecular Formula | C13H9BrClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.8ºC | |
| Name | N-(4-bromophenyl)sulfonylbenzenecarboximidoyl chloride |
|---|
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 463ºC at 760mmHg |
| Molecular Formula | C13H9BrClNO2S |
| Molecular Weight | 358.63800 |
| Flash Point | 233.8ºC |
| Exact Mass | 356.92300 |
| PSA | 54.88000 |
| LogP | 4.90420 |
| Index of Refraction | 1.629 |
| InChIKey | CFRCKJJVYIMSFW-SSZFMOIBSA-N |
| SMILES | O=S(=O)(N=C(Cl)c1ccccc1)c1ccc(Br)cc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |