1,2-bis(diethoxyphosphoryl)-3,3,4,4,5,5-hexafluoro-cyclopentene structure
|
Common Name | 1,2-bis(diethoxyphosphoryl)-3,3,4,4,5,5-hexafluoro-cyclopentene | ||
|---|---|---|---|---|
| CAS Number | 4655-86-1 | Molecular Weight | 448.23200 | |
| Density | 1.37g/cm3 | Boiling Point | 383.6ºC at 760 mmHg | |
| Molecular Formula | C13H20F6O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.8ºC | |
| Name | 3,4,5,3',4',5'-hexabromo-biphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 383.6ºC at 760 mmHg |
| Molecular Formula | C13H20F6O6P2 |
| Molecular Weight | 448.23200 |
| Flash Point | 185.8ºC |
| Exact Mass | 448.06400 |
| PSA | 90.68000 |
| LogP | 5.64970 |
| Index of Refraction | 1.411 |
| InChIKey | LBESMDBGRBPMJF-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)C1=C(P(=O)(OCC)OCC)C(F)(F)C(F)(F)C1(F)F |
|
~82%
1,2-bis(diethox... CAS#:4655-86-1 |
| Literature: Su, Debao; Guo, Cai-Yun; Willett, Roger D.; Scott, Brian; Kirchmeier, Robert L.; Shreeve, Jean'ne M. Journal of the American Chemical Society, 1990 , vol. 112, # 8 p. 3152 - 3155 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,3',4,4',5,5'-Hexadeutero-biphenyl |
| 3,3',4,4',5,5'-Hexabromodiphenyl |
| 3,3',4,4',5,5'-Hexabromobiphenyl |
| 3,3,4,4,5,5-Hexafluor-cyclopent-1-en-1,2-diphosphonsaeure-1,2-tetraaethyl-ester |
| 3,4,5,3',4',5'-hexadeuterio-biphenyl |
| Tetraaethyl-3,3,4,4,5,5-hexafluor-1-cyclopenten-1,2-ylendiphosphonat |
| tetraethyl 3,3,4,4,5,5-hexafluoro-1-cyclopenten-1,2-ylene-diphosphonate |
| 3,3',4,4',5,5'-Hexabromo-1,1'-biphenyl |
| Biphenyl-3,4,5,3',4',5'-d(6) |
| 1,1'-Biphenyl,3,3',4,4',5,5'-hexabromo |
| 3,4,5,3',4',5'-Hexabrom-biphenyl |