1-hydroxypleiadene-7,12-dione structure
|
Common Name | 1-hydroxypleiadene-7,12-dione | ||
|---|---|---|---|---|
| CAS Number | 4658-03-1 | Molecular Weight | 274.27000 | |
| Density | 1.431g/cm3 | Boiling Point | 519ºC at 760 mmHg | |
| Molecular Formula | C18H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.8ºC | |
| Name | 1-hydroxypleiadene-7,12-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.431g/cm3 |
|---|---|
| Boiling Point | 519ºC at 760 mmHg |
| Molecular Formula | C18H10O3 |
| Molecular Weight | 274.27000 |
| Flash Point | 281.8ºC |
| Exact Mass | 274.06300 |
| PSA | 54.37000 |
| LogP | 3.32080 |
| Index of Refraction | 1.754 |
| InChIKey | RYIXGBOAKDXYTQ-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)ccc3cccc1c23 |
| HS Code | 2914400090 |
|---|
|
~%
1-hydroxypleiad... CAS#:4658-03-1 |
| Literature: Rieche; Fruehwald Chemische Berichte, 1931 , vol. 64, p. 1603 |
|
~%
1-hydroxypleiad... CAS#:4658-03-1 |
| Literature: Knapp Monatshefte fuer Chemie, 1932 , vol. 60, p. 189,199 |
|
~%
1-hydroxypleiad... CAS#:4658-03-1 |
| Literature: Fieser Journal of the American Chemical Society, 1931 , vol. 53, p. 3546,3555 |
|
~%
1-hydroxypleiad... CAS#:4658-03-1 |
| Literature: Badger Journal of the Chemical Society, 1947 , p. 940,942 |
| Precursor 7 | |
|---|---|
| DownStream 3 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1-Hydroxy-7,12-dihydro-pleiaden-7,12-dion |
| 1-Hydroxy-pleiaden-7,12-dion |
| 1-hydroxy-pleiadene-7,12-dione |
| 7,12-Dihydro-1-hydroxy-pleiaden-7,12-dion |