Bullatine B structure
|
Common Name | Bullatine B | ||
|---|---|---|---|---|
| CAS Number | 466-26-2 | Molecular Weight | 437.570 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 578.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H39NO6 | Melting Point | 159-161 degºC | |
| MSDS | N/A | Flash Point | 303.5±30.1 °C | |
Use of Bullatine BNeoline, the active ingredient of processed aconite root (PA), alleviated oxaliplatin-induced peripheral neuropathy in mice. Neoline can be used as a marker compound to determine the quality of the PA products for the treatment of neuropathic pain[1]. |
| Name | Neoline |
|---|---|
| Synonym | More Synonyms |
| Description | Neoline, the active ingredient of processed aconite root (PA), alleviated oxaliplatin-induced peripheral neuropathy in mice. Neoline can be used as a marker compound to determine the quality of the PA products for the treatment of neuropathic pain[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 578.3±50.0 °C at 760 mmHg |
| Melting Point | 159-161 degºC |
| Molecular Formula | C24H39NO6 |
| Molecular Weight | 437.570 |
| Flash Point | 303.5±30.1 °C |
| Exact Mass | 437.277740 |
| PSA | 91.62000 |
| LogP | -1.69 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | XRARAKHBJHWUHW-RFESQMQVSA-N |
| SMILES | CCN1CC2(COC)CCC(O)C34C5CC6C(OC)CC(O)(C5C6O)C(C(OC)C23)C14 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
|
~%
Bullatine B CAS#:466-26-2 |
| Literature: Liang, Xihui; Desai, Haridutt K.; Joshi, Balawant S.; Pelletier, S. William Heterocycles, 1990 , vol. 31, # 10 p. 1889 - 1894 |
|
~%
Bullatine B CAS#:466-26-2 |
| Literature: Pelletier, S. William; Desai, Haridutt K.; Jiang, Quingping; Ross, Samir A. Phytochemistry (Elsevier), 1990 , vol. 29, # 11 p. 3649 - 3652 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Xuan-Wu 3 |
| Dideacetyldelphisine |
| Bullatine B |
| Aconitane-1,8,14-triol, 20-ethyl-6,16-dimethoxy-4-(methoxymethyl)- |
| 20-Ethyl-6,16-dimethoxy-4-(methoxymethyl)aconitane-1,8,14-triol |