1,1-bis(4-methoxyphenyl)-3,5,5-trimethyl-hexane
Modify Date: 2025-08-26 18:02:29
1,1-bis(4-methoxyphenyl)-3,5,5-trimethyl-hexane structure
|
Common Name | 1,1-bis(4-methoxyphenyl)-3,5,5-trimethyl-hexane | ||
|---|---|---|---|---|
| CAS Number | 4662-15-1 | Molecular Weight | 340.49900 | |
| Density | 0.972g/cm3 | Boiling Point | 439.3ºC at 760 mmHg | |
| Molecular Formula | C23H32O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.5ºC | |
| Name | 1-methoxy-4-[1-(4-methoxyphenyl)-3,5,5-trimethylhexyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.972g/cm3 |
|---|---|
| Boiling Point | 439.3ºC at 760 mmHg |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.49900 |
| Flash Point | 145.5ºC |
| Exact Mass | 340.24000 |
| PSA | 18.46000 |
| LogP | 6.29810 |
| Index of Refraction | 1.517 |
| InChIKey | ZPBVAICDICAXGO-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(CC(C)CC(C)(C)C)c2ccc(OC)cc2)cc1 |
| HS Code | 2909309090 |
|---|
|
~%
1,1-bis(4-metho... CAS#:4662-15-1 |
| Literature: Rogers et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 2991,2999 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,1-bis-(4-methoxy-phenyl)-3,5,5-trimethyl-hexane |
| 1,1'-(3,5,5-trimethylhexane-1,1-diyl)bis(4-methoxybenzene) |