2-Methyl-2-propanyl 4-methylbenzenesulfonate structure
|
Common Name | 2-Methyl-2-propanyl 4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 4664-57-7 | Molecular Weight | 228.308 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 322.8±11.0 °C at 760 mmHg | |
| Molecular Formula | C11H16O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.0±19.3 °C | |
| Name | tert-butyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 322.8±11.0 °C at 760 mmHg |
| Molecular Formula | C11H16O3S |
| Molecular Weight | 228.308 |
| Flash Point | 149.0±19.3 °C |
| Exact Mass | 228.082016 |
| PSA | 51.75000 |
| LogP | 2.53 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | DLRDEMODNIPHMU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OC(C)(C)C)cc1 |
| Storage condition | 2-8°C |
| HS Code | 2905199090 |
|---|
|
~77%
2-Methyl-2-prop... CAS#:4664-57-7 |
| Literature: Fazaeli, Razieh; Tangestaninejad, Shahram; Aliyan, Hamid Canadian Journal of Chemistry, 2006 , vol. 84, # 5 p. 812 - 818 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2905199090 |
|---|---|
| Summary | 2905199090. saturated monohydric alcohols. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Benzenesulfonic acid, 4-methyl-, 1,1-dimethylethyl ester |
| Benzenesulfonic acid,4-methyl-,1,1-dimethylethyl ester |
| p-Toluolsulfonsaeure-tert-butylester |
| tert-Butyltosylat |
| tert-Butyl TosylatennDISCONTINUED |
| 2-Methyl-2-propanyl 4-methylbenzenesulfonate |
| tert-Butyl-<toluol-4-sulfonat> |