Benzene,1,2,3-trimethoxy-4-(2-nitroethenyl)- structure
|
Common Name | Benzene,1,2,3-trimethoxy-4-(2-nitroethenyl)- | ||
|---|---|---|---|---|
| CAS Number | 4668-08-0 | Molecular Weight | 239.22500 | |
| Density | 1.203g/cm3 | Boiling Point | 370.3ºC at 760mmHg | |
| Molecular Formula | C11H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.9ºC | |
| Name | 1,2,3-trimethoxy-4-[(E)-2-nitroethenyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 370.3ºC at 760mmHg |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.22500 |
| Flash Point | 163.9ºC |
| Exact Mass | 239.07900 |
| PSA | 73.51000 |
| LogP | 2.48300 |
| Index of Refraction | 1.552 |
| InChIKey | UIAAKXDJMXMFMG-VOTSOKGWSA-N |
| SMILES | COc1ccc(C=C[N+](=O)[O-])c(OC)c1OC |
|
~87%
Benzene,1,2,3-t... CAS#:4668-08-0 |
| Literature: Yang, Su Hui; Song, Chin-Hee; Van, Hue Thi My; Park, Eunsook; Khadka, Daulat Bikram; Gong, Eun-Yeung; Lee, Keesook; Cho, Won-Jea Journal of Medicinal Chemistry, 2013 , vol. 56, # 8 p. 3414 - 3418 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Styrene,2,3,4-trimethoxy-b-nitro |
| 2,3,4,5,6-PENTAFLUOROPHENYL 5-BROMO-2-THIOPHENESULFONATE |