(3-BROMOPHENYL)(4-FLUOROPHENYL)METHANONE
(3-BROMOPHENYL)(4-FLUOROPHENYL)METHANONE structure
|
Common Name | (3-BROMOPHENYL)(4-FLUOROPHENYL)METHANONE | ||
|---|---|---|---|---|
| CAS Number | 46698-24-2 | Molecular Weight | 279.10400 | |
| Density | 1.485g/cm3 | Boiling Point | 362ºC at 760mmHg | |
| Molecular Formula | C13H8BrFO | Melting Point | 82-86ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 172.7ºC | |
Summary: 3- Bromo-4′-fluorodiphenylmethanone, Chinese name: 3-溴-4′-氟二苯甲酮, CAS number: 46698-24-2, molecular formula: C13H8BrFO, molecular weight: 279.10400. Solid, melting point 82-86°C. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3-bromophenyl)-(4-fluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.485g/cm3 |
|---|---|
| Boiling Point | 362ºC at 760mmHg |
| Melting Point | 82-86ºC(lit.) |
| Molecular Formula | C13H8BrFO |
| Molecular Weight | 279.10400 |
| Flash Point | 172.7ºC |
| Exact Mass | 277.97400 |
| PSA | 17.07000 |
| LogP | 3.81920 |
| Index of Refraction | 1.593 |
| InChIKey | QLWGPEHYNFONNA-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)c1cccc(Br)c1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914700090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:108-36-1
CAS#:116332-54-8
CAS#:247089-76-5This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-Fluor-m'-brombenzophenon |
| m-Brom-p'-fluorbenzophenon |
| 3-bromo-4'-fluorobenzophenone |
| MFCD00672034 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does (3-bromophenyl)-(4-fluorophenyl)methanone have? |
| A: English synonyms of (3-bromophenyl)-(4-fluorophenyl)methanone: p-Fluor-m'-brombenzophenon, m-Brom-p'-fluorbenzophenon, 3-bromo-4'-fluorobenzophenone, MFCD00672034. |
| Q: What are the downstream products of (3-bromophenyl)-(4-fluorophenyl)methanone? |
| A: Related downstream products(CAS) of (3-bromophenyl)-(4-fluorophenyl)methanone: 247089-76-5. |
| Q: What is the molecular weight of (3-bromophenyl)-(4-fluorophenyl)methanone? |
| A: Molecular weight of (3-bromophenyl)-(4-fluorophenyl)methanone is 279.10400. |
| Q: What is the melting point of (3-bromophenyl)-(4-fluorophenyl)methanone? |
| A: Melting point of (3-bromophenyl)-(4-fluorophenyl)methanone is 82-86ºC(lit.). |
| Q: What is the polar surface area (PSA) of (3-bromophenyl)-(4-fluorophenyl)methanone? |
| A: Polar surface area (PSA) of (3-bromophenyl)-(4-fluorophenyl)methanone is 17.07000. |
| Q: What are the upstream materials of (3-bromophenyl)-(4-fluorophenyl)methanone? |
| A: Related upstream materials(CAS) of (3-bromophenyl)-(4-fluorophenyl)methanone: 108-36-1;116332-54-8. |
| Q: What is the molecular formula of (3-bromophenyl)-(4-fluorophenyl)methanone? |
| A: Molecular formula of (3-bromophenyl)-(4-fluorophenyl)methanone is C13H8BrFO. |
| Q: What is the InChIKey of (3-bromophenyl)-(4-fluorophenyl)methanone? |
| A: InChIKey of (3-bromophenyl)-(4-fluorophenyl)methanone is QLWGPEHYNFONNA-UHFFFAOYSA-N. |
| Q: What is the boiling point of (3-bromophenyl)-(4-fluorophenyl)methanone? |
| A: Boiling point of (3-bromophenyl)-(4-fluorophenyl)methanone is 362ºC at 760mmHg. |
| Q: What is the SMILES notation of (3-bromophenyl)-(4-fluorophenyl)methanone? |
| A: SMILES notation of (3-bromophenyl)-(4-fluorophenyl)methanone is O=C(c1ccc(F)cc1)c1cccc(Br)c1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |