4-Acetamido-3-methoxybenzenesulfonyl chloride
4-Acetamido-3-methoxybenzenesulfonyl chloride structure
|
Common Name | 4-Acetamido-3-methoxybenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 46713-94-4 | Molecular Weight | 263.69800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Acetamido-3-methoxybenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10ClNO4S |
|---|---|
| Molecular Weight | 263.69800 |
| Exact Mass | 263.00200 |
| PSA | 84.34000 |
| LogP | 3.31140 |
| InChIKey | CTRQHACJJHWFLW-UHFFFAOYSA-N |
| SMILES | COc1cc(S(=O)(=O)Cl)ccc1NC(C)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-Acetamido-3-m... CAS#:46713-94-4 |
| Literature: Patel, Pratik R.; Ramalingan, Chennan; Park, Yong-Tae Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 23 p. 6610 - 6614 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| t0517-8561 |
| 4-(acetylamino)-3-methoxybenzenesulfonyl chloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-Acetamido-3-methoxybenzenesulfonyl chloride? |
| A: Molecular formula of 4-Acetamido-3-methoxybenzenesulfonyl chloride is C9H10ClNO4S. |
| Q: What is the InChIKey of 4-Acetamido-3-methoxybenzenesulfonyl chloride? |
| A: InChIKey of 4-Acetamido-3-methoxybenzenesulfonyl chloride is CTRQHACJJHWFLW-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 4-Acetamido-3-methoxybenzenesulfonyl chloride? |
| A: Polar surface area (PSA) of 4-Acetamido-3-methoxybenzenesulfonyl chloride is 84.34000. |
| Q: What is the LogP of 4-Acetamido-3-methoxybenzenesulfonyl chloride? |
| A: LogP of 4-Acetamido-3-methoxybenzenesulfonyl chloride is 3.31140. |
| Q: What English synonyms does 4-Acetamido-3-methoxybenzenesulfonyl chloride have? |
| A: English synonyms of 4-Acetamido-3-methoxybenzenesulfonyl chloride: t0517-8561, 4-(acetylamino)-3-methoxybenzenesulfonyl chloride. |
| Q: What is the CAS number of 4-Acetamido-3-methoxybenzenesulfonyl chloride? |
| A: CAS number of 4-Acetamido-3-methoxybenzenesulfonyl chloride is 46713-94-4. |
| Q: What is the English name of 4-Acetamido-3-methoxybenzenesulfonyl chloride? |
| A: The English name of 4-Acetamido-3-methoxybenzenesulfonyl chloride is 4-Acetamido-3-methoxybenzenesulfonyl chloride. |
| Q: What is the SMILES notation of 4-Acetamido-3-methoxybenzenesulfonyl chloride? |
| A: SMILES notation of 4-Acetamido-3-methoxybenzenesulfonyl chloride is COc1cc(S(=O)(=O)Cl)ccc1NC(C)=O. |
| Q: What is the molecular weight of 4-Acetamido-3-methoxybenzenesulfonyl chloride? |
| A: Molecular weight of 4-Acetamido-3-methoxybenzenesulfonyl chloride is 263.69800. |