1-methyl-4-[6-(4-methylphenyl)sulfonyloxyhexoxysulfonyl]benzene structure
|
Common Name | 1-methyl-4-[6-(4-methylphenyl)sulfonyloxyhexoxysulfonyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 4672-50-8 | Molecular Weight | 426.54700 | |
| Density | 1.235g/cm3 | Boiling Point | 585.6ºC at 760 mmHg | |
| Molecular Formula | C20H26O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308ºC | |
| Name | 6-(4-methylphenyl)sulfonyloxyhexyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.235g/cm3 |
|---|---|
| Boiling Point | 585.6ºC at 760 mmHg |
| Molecular Formula | C20H26O6S2 |
| Molecular Weight | 426.54700 |
| Flash Point | 308ºC |
| Exact Mass | 426.11700 |
| PSA | 103.50000 |
| LogP | 6.13620 |
| Index of Refraction | 1.547 |
| InChIKey | YZYYIAXSSKVOGE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCCOS(=O)(=O)c2ccc(C)cc2)cc1 |
|
~86%
1-methyl-4-[6-(... CAS#:4672-50-8 |
| Literature: Dyker, Gerald; Koerning, Jutta; Stirner, Wolfgang European Journal of Organic Chemistry, 1998 , # 1 p. 149 - 154 |
|
~10%
1-methyl-4-[6-(... CAS#:4672-50-8 |
| Literature: Bouzide, Abderrahim; Sauve, Gilles Organic Letters, 2002 , vol. 4, # 14 p. 2329 - 2332 |
|
~77%
1-methyl-4-[6-(... CAS#:4672-50-8 |
| Literature: Kim, Dong-Yeon; Kim, Hee-Jung; Yu, Kook-Hyun; Min, Jung-Joon Bioconjugate Chemistry, 2012 , vol. 23, # 3 p. 431 - 437 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| 1,8-bis(toluene-4-sulfonyloxy)-hexane |
| hexane-1,6-diyl-bis-(toluene-p-sulfonate) |
| 1,6-hexanediol |
| 1,6-hexanediol bis(p-toluenesulfonate) |
| 6-[(4-methylphenyl)sulfonyloxy]hexyl 4-methylbenzenesulfonate |
| TsO(CH2)6OTs |
| 1,6-bis(toluene-4-sulfonyloxy)hexane |
| hexane-1,6-diyl bis(4-methylbenzenesulfonate) |