7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate
Modify Date: 2026-04-13 12:31:54
7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate structure
|
Common Name | 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate | ||
|---|---|---|---|---|
| CAS Number | 467446-71-5 | Molecular Weight | 258.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate |
|---|
| Molecular Formula | C9H10N2O5S |
|---|---|
| Molecular Weight | 258.25 |
| InChIKey | QJTVUQMSHGMBHP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C(=C2N=C1)O)N)S(=O)(=O)O.O |
|
Name: Inhibition of BRD4 BD1 (unknown origin) at 10 uM using biotin labelled NeC: SGRG-K(Ac...
Source: ChEMBL
Target: Bromodomain-containing protein 4
External Id: CHEMBL4331532
|
|
Name: Inhibition of BRD4 BD1 (unknown origin) using biotin labelled NeC: SGRG-K(Ac)-GG-K(Ac...
Source: ChEMBL
Target: Bromodomain-containing protein 4
External Id: CHEMBL4331530
|
Total 2, Current Page 1 of 1
1