7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate
Modify Date: 2026-06-29 17:30:22
7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate structure
|
Common Name | 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate | ||
|---|---|---|---|---|
| CAS Number | 467446-71-5 | Molecular Weight | 258.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10N2O5S |
|---|---|
| Molecular Weight | 258.25 |
| InChIKey | QJTVUQMSHGMBHP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C(=C2N=C1)O)N)S(=O)(=O)O.O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of BRD4 BD1 (unknown origin) at 10 uM using biotin labelled NeC: SGRG-K(Ac...
Source: ChEMBL
Target: Bromodomain-containing protein 4
External Id: CHEMBL4331532
|
|
Name: Inhibition of BRD4 BD1 (unknown origin) using biotin labelled NeC: SGRG-K(Ac)-GG-K(Ac...
Source: ChEMBL
Target: Bromodomain-containing protein 4
External Id: CHEMBL4331530
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate? |
| A: Molecular formula of 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate is C9H10N2O5S. |
| Q: What is the CAS number of 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate? |
| A: CAS number of 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate is 467446-71-5. |
| Q: What is the Chinese name of 467446-71-5? |
| A: Chinese name of 467446-71-5 is 467446-71-5. |
| Q: What is the molecular weight of 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate? |
| A: Molecular weight of 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate is 258.25. |
| Q: What is the English name of 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate? |
| A: The English name of 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate is 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate. |
| Q: What is the InChIKey of 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate? |
| A: InChIKey of 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate is QJTVUQMSHGMBHP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate? |
| A: SMILES notation of 7-Amino-8-hydroxyquinoline-5-sulfonic acid hydrate is C1=CC2=C(C=C(C(=C2N=C1)O)N)S(=O)(=O)O.O. |