2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole
Modify Date: 2025-10-17 14:03:49
![2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole Structure](https://www.chemsrc.com/extcaspic/433/4677-07-0.png)
2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole structure
|
Common Name | 2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 4677-07-0 | Molecular Weight | 263.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H17N3 |
|---|---|
| Molecular Weight | 263.34 |
| InChIKey | AOYYMJFDAJKPSG-UHFFFAOYSA-N |
| SMILES | CC1(C)C(C=NNc2ccccc2)=Nc2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole? |
| A: CAS number of 2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole is 4677-07-0. |
| Q: What is the English name of 2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole? |
| A: The English name of 2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole is 2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole. |
| Q: What is the molecular formula of 2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole? |
| A: Molecular formula of 2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole is C17H17N3. |
| Q: What is the InChIKey of 2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole? |
| A: InChIKey of 2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole is AOYYMJFDAJKPSG-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole? |
| A: SMILES notation of 2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole is CC1(C)C(C=NNc2ccccc2)=Nc2ccccc21. |
| Q: What is the Chinese name of 4677-07-0? |
| A: Chinese name of 4677-07-0 is 4677-07-0. |
| Q: What is the molecular weight of 2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole? |
| A: Molecular weight of 2,3-Dihydro-3,3-dimethyl-2-[(2-phenyldiazenyl)methylene]-1H-indole is 263.34. |