1-[2-methoxy-5-(trifluoromethoxy)phenyl]ethanol structure
|
Common Name | 1-[2-methoxy-5-(trifluoromethoxy)phenyl]ethanol | ||
|---|---|---|---|---|
| CAS Number | 468074-91-1 | Molecular Weight | 236.18800 | |
| Density | 1.277g/cm3 | Boiling Point | 271.6ºC at 760 mmHg | |
| Molecular Formula | C10H11F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.1ºC | |
| Name | 1-[2-methoxy-5-(trifluoromethoxy)phenyl]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 271.6ºC at 760 mmHg |
| Molecular Formula | C10H11F3O3 |
| Molecular Weight | 236.18800 |
| Flash Point | 131.1ºC |
| Exact Mass | 236.06600 |
| PSA | 38.69000 |
| LogP | 2.64710 |
| Index of Refraction | 1.465 |
| InChIKey | DKUPMKWSJITPFC-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC(F)(F)F)cc1C(C)O |
| HS Code | 2909499000 |
|---|
|
~%
1-[2-methoxy-5-... CAS#:468074-91-1 |
| Literature: MERCK SHARP and DOHME LIMITED Patent: WO2004/31190 A1, 2004 ; Location in patent: Page 32 ; WO 2004/031190 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1-[2-Methoxy-5-(trifluoromethoxy)phenyl]ethan-1-ol |
| 1-Hydroxy-1-(2-methoxy-5-(trifluoromethoxy)phenyl)ethane |