(E)-methyl 2-(2-cyano-3-(4-hydroxyphenyl)acrylamido)benzoate
Modify Date: 2026-06-27 19:04:23
(E)-methyl 2-(2-cyano-3-(4-hydroxyphenyl)acrylamido)benzoate structure
|
Common Name | (E)-methyl 2-(2-cyano-3-(4-hydroxyphenyl)acrylamido)benzoate | ||
|---|---|---|---|---|
| CAS Number | 469872-84-2 | Molecular Weight | 322.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-methyl 2-(2-cyano-3-(4-hydroxyphenyl)acrylamido)benzoate |
|---|
| Molecular Formula | C18H14N2O4 |
|---|---|
| Molecular Weight | 322.3 |
| InChIKey | OMGYXARDHMFUSZ-JLHYYAGUSA-N |
| SMILES | COC(=O)C1=CC=CC=C1NC(=O)/C(=C/C2=CC=C(C=C2)O)/C#N |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1