N-Methyl-N-(2-oxido-1,3,2-oxazaphosphinan-2-yl)-N-(4-(2-phenylvinyl)phenyl)amine structure
|
Common Name | N-Methyl-N-(2-oxido-1,3,2-oxazaphosphinan-2-yl)-N-(4-(2-phenylvinyl)phenyl)amine | ||
|---|---|---|---|---|
| CAS Number | 470-13-3 | Molecular Weight | 328.34500 | |
| Density | 1.22g/cm3 | Boiling Point | 471.9ºC at 760 mmHg | |
| Molecular Formula | C18H21N2O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.2ºC | |
| Name | N-methyl-2-oxo-N-[4-[(E)-2-phenylethenyl]phenyl]-1,3,2λ5-oxazaphosphinan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 471.9ºC at 760 mmHg |
| Molecular Formula | C18H21N2O2P |
| Molecular Weight | 328.34500 |
| Flash Point | 239.2ºC |
| Exact Mass | 328.13400 |
| PSA | 51.38000 |
| LogP | 4.74000 |
| Vapour Pressure | 4.47E-09mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | SFQWNRRXORXBRQ-CMDGGOBGSA-N |
| SMILES | CN(c1ccc(C=Cc2ccccc2)cc1)P1(=O)NCCCO1 |
|
~%
N-Methyl-N-(2-o... CAS#:470-13-3 |
| Literature: Bahner,C.T. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 387 - 388 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-<N-Methyl-4-styryl-anilino>-tetrahydro-1.3.2-oxaza-phosphorin-2-oxid |