5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide
Modify Date: 2026-07-06 18:17:59
5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide structure
|
Common Name | 5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide | ||
|---|---|---|---|---|
| CAS Number | 470692-46-7 | Molecular Weight | 380.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H20Br2N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H20Br2N2O2S |
|---|---|
| Molecular Weight | 380.14 |
| InChIKey | UPDBWTRVCLZXJH-KVMRPWFXSA-N |
| SMILES | Br.Br.NC1CSC(CCCCC(=O)O)C1N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide? |
| A: Molecular formula of 5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide is C9H20Br2N2O2S. |
| Q: What is the InChIKey of 5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide? |
| A: InChIKey of 5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide is UPDBWTRVCLZXJH-KVMRPWFXSA-N. |
| Q: What is the molecular weight of 5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide? |
| A: Molecular weight of 5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide is 380.14. |
| Q: What is the SMILES notation of 5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide? |
| A: SMILES notation of 5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide is Br.Br.NC1CSC(CCCCC(=O)O)C1N. |
| Q: What is the Chinese name of 470692-46-7? |
| A: Chinese name of 470692-46-7 is 470692-46-7. |
| Q: What is the English name of 5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide? |
| A: The English name of 5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide is 5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide. |
| Q: What is the CAS number of 5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide? |
| A: CAS number of 5-((2R,3R,4S)-3,4-Diaminotetrahydrothiophen-2-yl)pentanoic acid dihydrobromide is 470692-46-7. |