Methyl 4-bromo-2,3,5,6-tetrafluorobenzoate
Modify Date: 2025-09-11 12:20:26
Methyl 4-bromo-2,3,5,6-tetrafluorobenzoate structure
|
Common Name | Methyl 4-bromo-2,3,5,6-tetrafluorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 4707-23-7 | Molecular Weight | 287.00600 | |
| Density | 1.789g/cm3 | Boiling Point | 286.8ºC at 760 mmHg | |
| Molecular Formula | C8H3BrF4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.2ºC | |
| Name | Methyl 4-bromo-2,3,5,6-tetrafluorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.789g/cm3 |
|---|---|
| Boiling Point | 286.8ºC at 760 mmHg |
| Molecular Formula | C8H3BrF4O2 |
| Molecular Weight | 287.00600 |
| Flash Point | 127.2ºC |
| Exact Mass | 285.92500 |
| PSA | 26.30000 |
| LogP | 2.79210 |
| Index of Refraction | 1.481 |
| InChIKey | BZKDYEDNQKCIJH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(F)c(F)c(Br)c(F)c1F |
| HS Code | 2916399090 |
|---|
|
~85%
Methyl 4-bromo-... CAS#:4707-23-7 |
| Literature: MERCK SERONO S.A.; THUNUGUNTLA, Siva Sanjeeva Rao; SUBRAMANYA, Hosahalli; KUNNAM, Satish Reddy; SANIVARU VIJAY, Sekhar Reddy; BINGI, Chakrapani; KUSANUR, Raviraj; SCHWARZ, Matthias; ARLT, Michael Patent: WO2010/115736 A2, 2010 ; Location in patent: Page/Page column 87 ; WO 2010/115736 A2 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Brom-2,2-dimethyl-acetessigsaeure-methylester |
| 4-Brom-2,3,5,6-tetrafluor-benzoesaeure-methylester |
| Butanoic acid,4-bromo-2,2-dimethyl-3-oxo-,methyl ester |
| 4-Brom-2,2-dimethyl-3-oxo-butansaeure-methylester |
| 4-bromo-2,3,5,6-tetrafluoro-benzoic acid methyl ester |
| 4-bromo-2,2-dimethyl acetoacetic acid methyl ester |
| methyl 4-bromo-2,2-dimethyl-3-oxobutyrate |
| methyl 4-bromo-2,2-dimethyl acetoacetate |