alpha-Boswellic acid structure
|
Common Name | alpha-Boswellic acid | ||
|---|---|---|---|---|
| CAS Number | 471-66-9 | Molecular Weight | 456.700 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 552.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 302.1±26.6 °C | |
Use of alpha-Boswellic acidalpha-Boswellic acid is a natural product. |
| Name | α-Boswellic Acid |
|---|---|
| Synonym | More Synonyms |
| Description | alpha-Boswellic acid is a natural product. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 552.7±50.0 °C at 760 mmHg |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.700 |
| Flash Point | 302.1±26.6 °C |
| Exact Mass | 456.360352 |
| PSA | 57.53000 |
| LogP | 9.43 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | BZXULBWGROURAF-VAIMLYEKSA-N |
| SMILES | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C(=O)O)C5CCC43C)C2C1 |
| Storage condition | -20°C |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 29181990 |
|
~%
alpha-Boswellic acid CAS#:471-66-9 |
| Literature: Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, , vol. 208, p. 10 Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, , vol. 211, p. 8 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| alpha-Boswellic acid |
| (3α)-3-Hydroxyolean-12-en-24-oic acid |
| α-BOSWELLIC ACID |
| Boswellic acid |