Lupane structure
|
Common Name | Lupane | ||
|---|---|---|---|---|
| CAS Number | 471-67-0 | Molecular Weight | 412.734 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 457.4±12.0 °C at 760 mmHg | |
| Molecular Formula | C30H52 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.8±13.1 °C | |
| Name | (4aS,6aR,6aR,6bR,8aR,12aS,14aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 457.4±12.0 °C at 760 mmHg |
| Molecular Formula | C30H52 |
| Molecular Weight | 412.734 |
| Flash Point | 221.8±13.1 °C |
| Exact Mass | 412.406891 |
| LogP | 13.33 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | VCNKUCWWHVTTBY-KQCVGMHHSA-N |
| SMILES | CC1(C)CCC2(C)CCC3(C)C(CCC4C5(C)CCCC(C)(C)C5CCC43C)C2C1 |
|
Name: Metabolic Measurements from US Patent US11660306: "Treatment of Rett syndrome"
Source: BindingDB
Target: N/A
External Id: BindingDB_11269_1
|
| Lupane |
| oleanane |