17-Ethynylestriol structure
|
Common Name | 17-Ethynylestriol | ||
|---|---|---|---|---|
| CAS Number | 4717-40-2 | Molecular Weight | 312.403 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 479.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.6±23.3 °C | |
| Name | 17a-Ethynylestriol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 479.1±45.0 °C at 760 mmHg |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.403 |
| Flash Point | 221.6±23.3 °C |
| Exact Mass | 312.172546 |
| PSA | 60.69000 |
| LogP | 3.60 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | VSODIPLKPBLGCC-NADOGSGZSA-N |
| SMILES | C#CC1(O)C(O)CC2C3CCc4cc(O)ccc4C3CCC21C |
|
~%
17-Ethynylestriol CAS#:4717-40-2 |
| Literature: Engelfried; Gibian; Neumann; Prezewowsky; Schulz; Wiechert Arzneimittel-Forschung, 1966 , vol. 16, # 11 p. 1518 - 1522 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Relative binding affinity was measured on estrogen receptor of lamb uterine cytosol.
Source: ChEMBL
Target: Estrogen receptor beta
External Id: CHEMBL678830
|
|
Name: Relative binding affinity was measured on estrogen receptor of lamb uterine cytosol.
Source: ChEMBL
Target: Estrogen receptor beta
External Id: CHEMBL678829
|
| 17-ETHYNYLESTRADIOL |
| 17-Ethynylestriol |
| (16α,17α)-19-Norpregna-1,3,5(10)-trien-20-yne-3,16,17-triol |