Bromoanhydrotetrodoic lactone
Modify Date: 2025-09-10 08:57:51
Bromoanhydrotetrodoic lactone structure
|
Common Name | Bromoanhydrotetrodoic lactone | ||
|---|---|---|---|---|
| CAS Number | 47179-57-7 | Molecular Weight | 380.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14BrN3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Bromoanhydrotetrodoic lactone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14BrN3O7 |
|---|---|
| Molecular Weight | 380.15 |
| InChIKey | HMRYQXULXRWZDD-OMHISGFOSA-N |
| SMILES | NC1=NC2OC3(CO)C(O)C4OC(=O)C(O)C4(N1)C2(Br)C3O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Bromoanhydrotetrodoic lactone? |
| A: SMILES notation of Bromoanhydrotetrodoic lactone is NC1=NC2OC3(CO)C(O)C4OC(=O)C(O)C4(N1)C2(Br)C3O. |
| Q: What is the InChIKey of Bromoanhydrotetrodoic lactone? |
| A: InChIKey of Bromoanhydrotetrodoic lactone is HMRYQXULXRWZDD-OMHISGFOSA-N. |
| Q: What is the English name of Bromoanhydrotetrodoic lactone? |
| A: The English name of Bromoanhydrotetrodoic lactone is Bromoanhydrotetrodoic lactone. |
| Q: What is the Chinese name of 47179-57-7? |
| A: Chinese name of 47179-57-7 is 47179-57-7. |
| Q: What is the CAS number of Bromoanhydrotetrodoic lactone? |
| A: CAS number of Bromoanhydrotetrodoic lactone is 47179-57-7. |
| Q: What is the molecular weight of Bromoanhydrotetrodoic lactone? |
| A: Molecular weight of Bromoanhydrotetrodoic lactone is 380.15. |
| Q: What is the molecular formula of Bromoanhydrotetrodoic lactone? |
| A: Molecular formula of Bromoanhydrotetrodoic lactone is C11H14BrN3O7. |