I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile
Modify Date: 2026-07-12 19:49:58
![I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile Structure](https://www.chemsrc.com/extcaspic/448/471908-15-3.png)
I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile structure
|
Common Name | I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile | ||
|---|---|---|---|---|
| CAS Number | 471908-15-3 | Molecular Weight | 410.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H18N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H18N4OS |
|---|---|
| Molecular Weight | 410.5 |
| InChIKey | YIOKFDISHFDPAQ-UHFFFAOYSA-N |
| SMILES | N#CC(C(=O)CSc1nnc(-c2ccccc2)n1-c1ccccc1)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile? |
| A: The English name of I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile is I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile. |
| Q: What is the SMILES notation of I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile? |
| A: SMILES notation of I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile is N#CC(C(=O)CSc1nnc(-c2ccccc2)n1-c1ccccc1)c1ccccc1. |
| Q: What is the Chinese name of 471908-15-3? |
| A: Chinese name of 471908-15-3 is 471908-15-3. |
| Q: What is the molecular weight of I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile? |
| A: Molecular weight of I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile is 410.5. |
| Q: What is the molecular formula of I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile? |
| A: Molecular formula of I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile is C24H18N4OS. |
| Q: What is the CAS number of I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile? |
| A: CAS number of I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile is 471908-15-3. |
| Q: What is the InChIKey of I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile? |
| A: InChIKey of I+/--[2-[(4,5-Diphenyl-4H-1,2,4-triazol-3-yl)thio]acetyl]benzeneacetonitrile is YIOKFDISHFDPAQ-UHFFFAOYSA-N. |