3-amino-2,2-difluoro-3-(4-fluorophenyl)propanoic acid,hydrochloride structure
|
Common Name | 3-amino-2,2-difluoro-3-(4-fluorophenyl)propanoic acid,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 471931-01-8 | Molecular Weight | 255.62100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-amino-2,2-difluoro-3-(4-fluorophenyl)propanoic acid,hydrochloride |
|---|
| Molecular Formula | C9H9ClF3NO2 |
|---|---|
| Molecular Weight | 255.62100 |
| Exact Mass | 255.02700 |
| PSA | 63.32000 |
| LogP | 3.04770 |
| InChIKey | ZEPDMGWEHMEEMW-UHFFFAOYSA-N |
| SMILES | Cl.NC(c1ccc(F)cc1)C(F)(F)C(=O)O |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |