2-chloro-5-methylsulfonyl-1,3-dinitrobenzene structure
|
Common Name | 2-chloro-5-methylsulfonyl-1,3-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 4726-15-2 | Molecular Weight | 280.64200 | |
| Density | 1.682g/cm3 | Boiling Point | 468.3ºC at 760mmHg | |
| Molecular Formula | C7H5ClN2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237ºC | |
| Name | 2-chloro-5-methylsulfonyl-1,3-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.682g/cm3 |
|---|---|
| Boiling Point | 468.3ºC at 760mmHg |
| Molecular Formula | C7H5ClN2O6S |
| Molecular Weight | 280.64200 |
| Flash Point | 237ºC |
| Exact Mass | 279.95600 |
| PSA | 134.16000 |
| LogP | 3.68710 |
| Index of Refraction | 1.6 |
| InChIKey | XOXDOVDWSOCMQD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
|
~%
2-chloro-5-meth... CAS#:4726-15-2 |
| Literature: Wright,J.B. et al. Journal of Medicinal Chemistry, 1978 , vol. 21, p. 930 - 935 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Chlor-3,5-dinitrophenylmethylsulfon |
| 4-Chloro-3,5-dinitrophenylmethyl sulfone |