(2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methanol structure
|
Common Name | (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methanol | ||
|---|---|---|---|---|
| CAS Number | 4728-14-7 | Molecular Weight | 191.18200 | |
| Density | 1.28g/cm3 | Boiling Point | 303.1ºC at 760 mmHg | |
| Molecular Formula | C7H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.1ºC | |
| Name | (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 303.1ºC at 760 mmHg |
| Molecular Formula | C7H13NO5 |
| Molecular Weight | 191.18200 |
| Flash Point | 137.1ºC |
| Exact Mass | 191.07900 |
| PSA | 84.51000 |
| LogP | 0.30030 |
| Index of Refraction | 1.494 |
| InChIKey | QELOUXQKMTYFPK-UHFFFAOYSA-N |
| SMILES | CC1(C)OCC(CO)([N+](=O)[O-])CO1 |
|
~75%
(2,2-dimethyl-5... CAS#:4728-14-7 |
| Literature: Majewski, Marek; Gleave, D. Mark; Nowak, Pawel Canadian Journal of Chemistry, 1995 , vol. 73, # 10 p. 1616 - 1626 |
|
~85%
(2,2-dimethyl-5... CAS#:4728-14-7 |
| Literature: W. R. Grace and Co.-Conn. Patent: US4851588 A1, 1989 ; |
|
~97%
(2,2-dimethyl-5... CAS#:4728-14-7 |
| Literature: Morin, Jesse B.; Sello, Jason K. Organic Letters, 2010 , vol. 12, # 15 p. 3522 - 3524 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| (2,2-dimethyl-2-nitro-1,3-dioxan-5-yl)methanol |
| 2,2-dimethyl-5-hydroxymethyl-5-nitro-1,3-dioxane |
| 2,2-dimethyl-5-nitro-1,3-dioxan-5-yl-methanol |
| 5-(hydroxymethyl)-2,2-dimethyl-5-nitro-1,3-dioxane |
| 2,2-(O,O-isopropylidenedioxymethyl)-2-nitroethanol |
| 2-hydroxymethyl-2-nitropropane-1,3-diol monoacetonide |