tert-butyl 2-[(4S,6S)-6-[2-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate structure
|
Common Name | tert-butyl 2-[(4S,6S)-6-[2-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate | ||
|---|---|---|---|---|
| CAS Number | 472967-95-6 | Molecular Weight | 654.81000 | |
| Density | 1.15g/cm3 | Boiling Point | 678.035ºC at 760 mmHg | |
| Molecular Formula | C40H47FN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 363.863ºC | |
| Name | tert-butyl 2-[(4S,6S)-6-[2-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 678.035ºC at 760 mmHg |
| Molecular Formula | C40H47FN2O5 |
| Molecular Weight | 654.81000 |
| Flash Point | 363.863ºC |
| Exact Mass | 654.34700 |
| PSA | 78.79000 |
| LogP | 9.44200 |
| Index of Refraction | 1.569 |
| InChIKey | NPPZOMYSGNZDKY-ACHIHNKUSA-N |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CCC1CC(CC(=O)OC(C)(C)C)OC(C)(C)O1 |
|
~%
tert-butyl 2-[(... CAS#:472967-95-6 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 73, # 2 p. 229 - 246 |
| Atorvastatin acetonide |
| ATV-1 acetonide |